Products 1226808-00-9
CAS 1226808-00-9 is the registry number for tert-Butyl 7-chloro-2-oxo-2,3-dihydro-1H-benzo[e][1,4]diazepine-4(5H)-carboxylate, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl 7-chloro-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate (CAS 1226808-00-9) is a chemical compound with the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. IUPAC name: tert-butyl 7-chloro-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate. InChIKey: ORICBLUVZGJEFV-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O3 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | tert-butyl 7-chloro-2-oxo-3,5-dihydro-1H-1,4-benzodiazepine-4-carboxylate |
| InChIKey | ORICBLUVZGJEFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C=CC(=C2)Cl)NC(=O)C1 |
Computed by PubChem (NCBI)