Products 122714-53-8

CAS 122714-53-8 is the registry number for Ethyl 4-(6-acetyl-3-hydroxy-2-propylphenoxy)butyrate. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(6-acetyl-3-hydroxy-2-propylphenoxy)butanoate (CAS 122714-53-8) is a chemical compound with the molecular formula C17H24O5 and a molecular weight of 308.4 g/mol. IUPAC name: ethyl 4-(6-acetyl-3-hydroxy-2-propylphenoxy)butanoate. InChIKey: MEFUYKDJCOTBGV-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O5
Molecular weight308.4 g/mol
IUPAC nameethyl 4-(6-acetyl-3-hydroxy-2-propylphenoxy)butanoate
InChIKeyMEFUYKDJCOTBGV-UHFFFAOYSA-N
SMILESCCCC1=C(C=CC(=C1OCCCC(=O)OCC)C(=O)C)O

Computed by PubChem (NCBI)