Products 24124-03-6

CAS 24124-03-6 is the registry number for 2-Isopropyl-2-(benzyloxy)-propanedioic acid 1,3-diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl 2-phenylmethoxy-2-propan-2-ylpropanedioate (CAS 24124-03-6) is a chemical compound with the molecular formula C17H24O5 and a molecular weight of 308.4 g/mol. IUPAC name: diethyl 2-phenylmethoxy-2-propan-2-ylpropanedioate. InChIKey: LRMLTYOJCFBKLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O5
Molecular weight308.4 g/mol
IUPAC namediethyl 2-phenylmethoxy-2-propan-2-ylpropanedioate
InChIKeyLRMLTYOJCFBKLZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C)C)(C(=O)OCC)OCC1=CC=CC=C1

Computed by PubChem (NCBI)