CAS 1332965-98-6 appears in our catalog under these names: 1,2-Benzenedicarboxylic Acid 1-(7-Hydroxy-4-methyloctyl) Ester-d4(Mixture of Diastereomers), 1,2–Benzenedicarboxylic Acid 1–(7–Hydroxy–4–methyloctyl) Ester–d4. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 50mg.
2,3,4,5-tetradeuterio-6-(7-hydroxy-4-methyloctoxy)carbonylbenzoic acid (CAS 1332965-98-6) is a chemical compound with the molecular formula C17H24O5 and a molecular weight of 312.39 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(7-hydroxy-4-methyloctoxy)carbonylbenzoic acid. InChIKey: RWCHSWLUPRJYEX-KNIGXJNHSA-N.
| Molecular formula | C17H24O5 |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(7-hydroxy-4-methyloctoxy)carbonylbenzoic acid |
| InChIKey | RWCHSWLUPRJYEX-KNIGXJNHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(C)CCC(C)O)[2H])[2H] |
Computed by PubChem (NCBI)