Products 88420-31-9

CAS 88420-31-9 is the registry number for 4-(4-Acetyl-3-hydroxy-2-propylphenoxy)butanoic Acid Ethyl Ester. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(4-acetyl-3-hydroxy-2-propylphenoxy)butanoate (CAS 88420-31-9) is a chemical compound with the molecular formula C17H24O5 and a molecular weight of 308.4 g/mol. IUPAC name: ethyl 4-(4-acetyl-3-hydroxy-2-propylphenoxy)butanoate. InChIKey: DTLRCWBKCYZCKY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24O5
Molecular weight308.4 g/mol
IUPAC nameethyl 4-(4-acetyl-3-hydroxy-2-propylphenoxy)butanoate
InChIKeyDTLRCWBKCYZCKY-UHFFFAOYSA-N
SMILESCCCC1=C(C=CC(=C1O)C(=O)C)OCCCC(=O)OCC

Computed by PubChem (NCBI)