Products 1227153-21-0
CAS 1227153-21-0 is the registry number for 5-(Difluoromethoxy)-2-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(difluoromethoxy)-2-methylbenzoic acid (CAS 1227153-21-0) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 5-(difluoromethoxy)-2-methylbenzoic acid. InChIKey: XEUPBYMJZYUGHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 5-(difluoromethoxy)-2-methylbenzoic acid |
| InChIKey | XEUPBYMJZYUGHQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)