Products 1227203-49-7
CAS 1227203-49-7 is the registry number for 5-Benzyl-2,2,3-trimethylimidazolidin-4-one hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-benzyl-2,2,3-trimethylimidazolidin-4-one;hydrochloride (CAS 1227203-49-7) is a chemical compound with the molecular formula C13H19ClN2O and a molecular weight of 254.75 g/mol. IUPAC name: 5-benzyl-2,2,3-trimethylimidazolidin-4-one;hydrochloride. InChIKey: YIYFEXGDFJLJGM-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O |
|---|---|
| Molecular weight | 254.75 g/mol |
| IUPAC name | 5-benzyl-2,2,3-trimethylimidazolidin-4-one;hydrochloride |
| InChIKey | YIYFEXGDFJLJGM-UHFFFAOYSA-N |
| SMILES | CC1(NC(C(=O)N1C)CC2=CC=CC=C2)C.Cl |
Computed by PubChem (NCBI)