CAS 1227294-01-0 is the registry number for Clopidogrel Alcohol. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
(2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethaneperoxoic acid (CAS 1227294-01-0) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethaneperoxoic acid. InChIKey: SRWBFRNQVNLNQI-AWEZNQCLSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethaneperoxoic acid |
| InChIKey | SRWBFRNQVNLNQI-AWEZNQCLSA-N |
| SMILES | C1CN(CC2=C1SC=C2)[C@@H](C3=CC=CC=C3Cl)C(=O)OO |
Computed by PubChem (NCBI)