CAS 1319197-73-3 appears in our catalog under these names: Clopidogrel Impurity 50, (S)-Clopidogrel Carboxylic Acid N-Oxide, 5-((S)-Carboxy(2-chlorophenyl)methyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine 5-oxide 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetic acid (CAS 1319197-73-3) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetic acid. InChIKey: QPWIEQMKVSKDGT-MBIQTGHCSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-(5-oxido-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ium-5-yl)acetic acid |
| InChIKey | QPWIEQMKVSKDGT-MBIQTGHCSA-N |
| SMILES | C1C[N+](CC2=C1SC=C2)([C@@H](C3=CC=CC=C3Cl)C(=O)O)[O-] |
Computed by PubChem (NCBI)