CAS 365542-32-1 is the registry number for Ethyl (E)-2-(2-(4-chlorothiazol-5-yl)vinyl)-6-methoxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(E)-2-(4-chloro-1,3-thiazol-5-yl)ethenyl]-6-methoxybenzoate (CAS 365542-32-1) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: ethyl 2-[(E)-2-(4-chloro-1,3-thiazol-5-yl)ethenyl]-6-methoxybenzoate. InChIKey: DBGNENYJHBUAPX-BQYQJAHWSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | ethyl 2-[(E)-2-(4-chloro-1,3-thiazol-5-yl)ethenyl]-6-methoxybenzoate |
| InChIKey | DBGNENYJHBUAPX-BQYQJAHWSA-N |
| SMILES | CCOC(=O)C1=C(C=CC=C1OC)/C=C/C2=C(N=CS2)Cl |
Computed by PubChem (NCBI)