Products 100827-77-8

CAS 100827-77-8 is the registry number for 2-Amino-3-(2-chlorobenzoyl)-5-(2-carbomethoxyethyl)thiophene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Methyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate (CAS 100827-77-8) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: methyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate. InChIKey: LZTUUSFBUKOHGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClNO3S
Molecular weight323.8 g/mol
IUPAC namemethyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate
InChIKeyLZTUUSFBUKOHGQ-UHFFFAOYSA-N
SMILESCOC(=O)CCC1=CC(=C(S1)N)C(=O)C2=CC=CC=C2Cl

Computed by PubChem (NCBI)