CAS 100827-77-8 is the registry number for 2-Amino-3-(2-chlorobenzoyl)-5-(2-carbomethoxyethyl)thiophene. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Methyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate (CAS 100827-77-8) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: methyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate. InChIKey: LZTUUSFBUKOHGQ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | methyl 3-[5-amino-4-(2-chlorobenzoyl)thiophen-2-yl]propanoate |
| InChIKey | LZTUUSFBUKOHGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=CC(=C(S1)N)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)