CAS 2862766-75-2 is the registry number for 3-Methyl-4-(2-methylbenzamido)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-4-[(2-methylbenzoyl)amino]benzenesulfonyl chloride (CAS 2862766-75-2) is a chemical compound with the molecular formula C15H14ClNO3S and a molecular weight of 323.8 g/mol. IUPAC name: 3-methyl-4-[(2-methylbenzoyl)amino]benzenesulfonyl chloride. InChIKey: CWGKMKMNGZZYGK-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO3S |
|---|---|
| Molecular weight | 323.8 g/mol |
| IUPAC name | 3-methyl-4-[(2-methylbenzoyl)amino]benzenesulfonyl chloride |
| InChIKey | CWGKMKMNGZZYGK-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=C(C=C(C=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)