CAS 122733-39-5 appears in our catalog under these names: 2-Methyl-5-(3-nitrophenyl)-1,3,4-oxadiazole, 95%, 2-Methyl-5-(3-nitro-phenyl)-(1,3,4)oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g.
2-methyl-5-(3-nitrophenyl)-1,3,4-oxadiazole (CAS 122733-39-5) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 2-methyl-5-(3-nitrophenyl)-1,3,4-oxadiazole. InChIKey: BYZKBOZDHYZRQF-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-methyl-5-(3-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | BYZKBOZDHYZRQF-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)