CAS 52570-56-6 is the registry number for 2-Cyano-n-(3-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-cyano-N-(3-nitrophenyl)acetamide (CAS 52570-56-6) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 2-cyano-N-(3-nitrophenyl)acetamide. InChIKey: YCDLCHVIKUNVHM-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-cyano-N-(3-nitrophenyl)acetamide |
| InChIKey | YCDLCHVIKUNVHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)CC#N |
Computed by PubChem (NCBI)