CAS 80987-71-9 appears in our catalog under these names: 5-(2H-1,3-Benzodioxol-5-yl)-1,3,4-oxadiazol-2-amine, 95%, 5-(Benzo(d)(1,3)dioxol-5-yl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-amine (CAS 80987-71-9) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-amine. InChIKey: RDYBBDXAHGPAOB-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | RDYBBDXAHGPAOB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)