Products 25283-98-1
CAS 25283-98-1 appears in our catalog under these names: 5-Methyl-3-(3-nitrophenyl)-1,2,4-oxadiazole, 95%, 5-Methyl-3-(3-nitrophenyl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-methyl-3-(3-nitrophenyl)-1,2,4-oxadiazole (CAS 25283-98-1) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 5-methyl-3-(3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: ZGPVCGAEIHFMLX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-methyl-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | ZGPVCGAEIHFMLX-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)