Products 1227382-08-2

CAS 1227382-08-2 is the registry number for Benzyl 2,6-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 2,8-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 1227382-08-2) is a chemical compound with the molecular formula C15H21ClN2O2 and a molecular weight of 296.79 g/mol. IUPAC name: benzyl 2,8-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: IGJILHKIUYOANS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21ClN2O2
Molecular weight296.79 g/mol
IUPAC namebenzyl 2,8-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride
InChIKeyIGJILHKIUYOANS-UHFFFAOYSA-N
SMILESC1CC2(CNC1)CN(C2)C(=O)OCC3=CC=CC=C3.Cl

Computed by PubChem (NCBI)