CAS 1227465-76-0 is the registry number for (1-Methyl-4,5,6,7-tetrahydro-1h-pyrazolo[4,3-c]pyridin-3-yl)methanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanol;hydrochloride (CAS 1227465-76-0) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: (1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanol;hydrochloride. InChIKey: JYJWUNFWFXPMFA-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | (1-methyl-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanol;hydrochloride |
| InChIKey | JYJWUNFWFXPMFA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CNCC2)C(=N1)CO.Cl |
Computed by PubChem (NCBI)