CAS 1227487-48-0 appears in our catalog under these names: 1-(4-Fluorophenyl)piperidin-4-amine dihydrochloride, 95%, 1-(4-Fluorophenyl)piperidin-4-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
1-(4-fluorophenyl)piperidin-4-amine;dihydrochloride (CAS 1227487-48-0) is a chemical compound with the molecular formula C11H17Cl2FN2 and a molecular weight of 267.17 g/mol. IUPAC name: 1-(4-fluorophenyl)piperidin-4-amine;dihydrochloride. InChIKey: SVEDGTMCHHLGIL-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2FN2 |
|---|---|
| Molecular weight | 267.17 g/mol |
| IUPAC name | 1-(4-fluorophenyl)piperidin-4-amine;dihydrochloride |
| InChIKey | SVEDGTMCHHLGIL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=CC=C(C=C2)F.Cl.Cl |
Computed by PubChem (NCBI)