CAS 199672-04-3 is the registry number for 1-(3-Fluorobenzyl)Piperazine Dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 5g.
1-[(3-fluorophenyl)methyl]piperazine;dihydrochloride (CAS 199672-04-3) is a chemical compound with the molecular formula C11H17Cl2FN2 and a molecular weight of 267.17 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]piperazine;dihydrochloride. InChIKey: BRNBEBNBUUJUPC-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2FN2 |
|---|---|
| Molecular weight | 267.17 g/mol |
| IUPAC name | 1-[(3-fluorophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | BRNBEBNBUUJUPC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=CC=C2)F.Cl.Cl |
Computed by PubChem (NCBI)