CAS 2368804-56-0 is the registry number for (3R,4R)-1-Benzyl-4-fluoropyrrolidin-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-1-benzyl-4-fluoropyrrolidin-3-amine;dihydrochloride (CAS 2368804-56-0) is a chemical compound with the molecular formula C11H17Cl2FN2 and a molecular weight of 267.17 g/mol. IUPAC name: (3R,4R)-1-benzyl-4-fluoropyrrolidin-3-amine;dihydrochloride. InChIKey: RHJWKCYEJWZTQQ-IUDGJIIWSA-N.
| Molecular formula | C11H17Cl2FN2 |
|---|---|
| Molecular weight | 267.17 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-4-fluoropyrrolidin-3-amine;dihydrochloride |
| InChIKey | RHJWKCYEJWZTQQ-IUDGJIIWSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)F)N.Cl.Cl |
Computed by PubChem (NCBI)