CAS 1311316-92-3 appears in our catalog under these names: 1-(3-Fluorophenyl)piperidin-3-amine dihydrochloride, 1-(3-Fluorophenyl)piperidin-3-amine dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(3-fluorophenyl)piperidin-3-amine;dihydrochloride (CAS 1311316-92-3) is a chemical compound with the molecular formula C11H17Cl2FN2 and a molecular weight of 267.17 g/mol. IUPAC name: 1-(3-fluorophenyl)piperidin-3-amine;dihydrochloride. InChIKey: FJLJRTSSBVYSDO-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2FN2 |
|---|---|
| Molecular weight | 267.17 g/mol |
| IUPAC name | 1-(3-fluorophenyl)piperidin-3-amine;dihydrochloride |
| InChIKey | FJLJRTSSBVYSDO-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC(=CC=C2)F)N.Cl.Cl |
Computed by PubChem (NCBI)