Products 1227499-99-1
CAS 1227499-99-1 is the registry number for 2-Chloro-4-methoxy-5-(trifluoromethyl)pyridine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4-methoxy-5-(trifluoromethyl)pyridine (CAS 1227499-99-1) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 2-chloro-4-methoxy-5-(trifluoromethyl)pyridine. InChIKey: ZETMFNUAHWLLIB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 2-chloro-4-methoxy-5-(trifluoromethyl)pyridine |
| InChIKey | ZETMFNUAHWLLIB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)