Products 1227513-73-6

CAS 1227513-73-6 is the registry number for 2-Hydroxy-5-methylpyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-methyl-2-oxo-1H-pyridine-4-carboxylic acid (CAS 1227513-73-6) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 5-methyl-2-oxo-1H-pyridine-4-carboxylic acid. InChIKey: QQSRJFBZTBSESC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7NO3
Molecular weight153.14 g/mol
IUPAC name5-methyl-2-oxo-1H-pyridine-4-carboxylic acid
InChIKeyQQSRJFBZTBSESC-UHFFFAOYSA-N
SMILESCC1=CNC(=O)C=C1C(=O)O

Computed by PubChem (NCBI)