CAS 1227694-91-8 is the registry number for Zaleplon Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]formamide (CAS 1227694-91-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]formamide. InChIKey: QZTDUILAIJDPCH-VOTSOKGWSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]formamide |
| InChIKey | QZTDUILAIJDPCH-VOTSOKGWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=CC=C1)NC=O |
Computed by PubChem (NCBI)