Products 1227827-88-4
CAS 1227827-88-4 appears in our catalog under these names: EP3 antagonist 3, EP3 antagonist 3, EP3 antagonist 3, 99.52%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 2mg, 25 mg, 100 mg, 10mM/1mL, 50 mg.
5-(6-naphthalen-2-yl-2-oxo-1H-pyridin-3-yl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione (CAS 1227827-88-4) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: 5-(6-naphthalen-2-yl-2-oxo-1H-pyridin-3-yl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione. InChIKey: HXVAXOYPIPUCRY-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 5-(6-naphthalen-2-yl-2-oxo-1H-pyridin-3-yl)-5-propan-2-yl-1,3-oxazolidine-2,4-dione |
| InChIKey | HXVAXOYPIPUCRY-UHFFFAOYSA-N |
| SMILES | CC(C)C1(C(=O)NC(=O)O1)C2=CC=C(NC2=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)
Synonyms:
orb1688680