CAS 195387-29-2 appears in our catalog under these names: 4-(9H-Fluoren-9-ylmethoxycarbonylamino)-1-methyl-1H-pyrrole-2-carboxylic acid, 97%, 4–(Fmoc–amino)–1–methyl–1H–pyrrole–2–carboxylic acid, Fmoc-Py-OH, 4-(Fmoc-amino)-1-methyl-1H-pyrrole-2-carboxylic Acid, >97.0%(HPLC)(T), Fmoc-4-amino-1-methylpyrrole-2-carboxylic acid 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg, 25g.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid (CAS 195387-29-2) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid. InChIKey: GHRPKWXGCOWBLD-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-methylpyrrole-2-carboxylic acid |
| InChIKey | GHRPKWXGCOWBLD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)