Products 778625-03-9
CAS 778625-03-9 is the registry number for 9-Hydroxymethyl-2-(maleimidopropionylamino)fluorene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-dioxopyrrol-1-yl)-N-[9-(hydroxymethyl)-9H-fluoren-2-yl]propanamide (CAS 778625-03-9) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: 3-(2,5-dioxopyrrol-1-yl)-N-[9-(hydroxymethyl)-9H-fluoren-2-yl]propanamide. InChIKey: PVNUHVREGVTVKF-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O4 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 3-(2,5-dioxopyrrol-1-yl)-N-[9-(hydroxymethyl)-9H-fluoren-2-yl]propanamide |
| InChIKey | PVNUHVREGVTVKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C(C=C(C=C3)NC(=O)CCN4C(=O)C=CC4=O)C(C2=C1)CO |
Computed by PubChem (NCBI)