Products 1228956-95-3

CAS 1228956-95-3 is the registry number for Benzyl 3-(cbz-amino)picolinate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 3-(phenylmethoxycarbonylamino)pyridine-2-carboxylate (CAS 1228956-95-3) is a chemical compound with the molecular formula C21H18N2O4 and a molecular weight of 362.4 g/mol. IUPAC name: benzyl 3-(phenylmethoxycarbonylamino)pyridine-2-carboxylate. InChIKey: HJZNKUHGIWQTLI-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18N2O4
Molecular weight362.4 g/mol
IUPAC namebenzyl 3-(phenylmethoxycarbonylamino)pyridine-2-carboxylate
InChIKeyHJZNKUHGIWQTLI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)C2=C(C=CC=N2)NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)