Products 1227911-34-3

CAS 1227911-34-3 is the registry number for Cis-1-benzyl 3-methyl 6-methylpiperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate (CAS 1227911-34-3) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate. InChIKey: IJRRKWFHSQQJIY-GXTWGEPZSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC name1-O-benzyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate
InChIKeyIJRRKWFHSQQJIY-GXTWGEPZSA-N
SMILESC[C@H]1CC[C@H](CN1C(=O)OCC2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)