CAS 1228180-99-1 appears in our catalog under these names: 4,6-Dichlorofuro(3,4-c)pyridin-3(1H)-one, 98%, 4,6-Dichlorofuro[3,4-c]pyridin-3(1H)-one, 97%, 97%, 4,6-DICHLORO-1H-FURO[3,4-C]PYRIDIN-3-ONE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
4,6-dichloro-1H-furo[3,4-c]pyridin-3-one (CAS 1228180-99-1) is a chemical compound with the molecular formula C7H3Cl2NO2 and a molecular weight of 204.01 g/mol. IUPAC name: 4,6-dichloro-1H-furo[3,4-c]pyridin-3-one. InChIKey: BHVVRNQDBBLBLO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2 |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 4,6-dichloro-1H-furo[3,4-c]pyridin-3-one |
| InChIKey | BHVVRNQDBBLBLO-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=NC(=C2C(=O)O1)Cl)Cl |
Computed by PubChem (NCBI)