CAS 19932-89-9 is the registry number for 5,7-Dichlorobenzo[d]oxazol-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-3H-1,3-benzoxazol-2-one (CAS 19932-89-9) is a chemical compound with the molecular formula C7H3Cl2NO2 and a molecular weight of 204.01 g/mol. IUPAC name: 5,7-dichloro-3H-1,3-benzoxazol-2-one. InChIKey: DKVHXBWSNGQUFE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2 |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 5,7-dichloro-3H-1,3-benzoxazol-2-one |
| InChIKey | DKVHXBWSNGQUFE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)O2)Cl)Cl |
Computed by PubChem (NCBI)