CAS 5285-41-6 is the registry number for 5,6-Dichloro-2,3-dihydro-1,3-benzoxazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5,6-dichloro-3H-1,3-benzoxazol-2-one (CAS 5285-41-6) is a chemical compound with the molecular formula C7H3Cl2NO2 and a molecular weight of 204.01 g/mol. IUPAC name: 5,6-dichloro-3H-1,3-benzoxazol-2-one. InChIKey: WLWRBOFZMOBYJR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2 |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 5,6-dichloro-3H-1,3-benzoxazol-2-one |
| InChIKey | WLWRBOFZMOBYJR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)OC(=O)N2 |
Computed by PubChem (NCBI)