CAS 855996-73-5 is the registry number for 5,6-Dichloro-1,2-benzoxazol-3-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,6-dichloro-1,2-benzoxazol-3-one (CAS 855996-73-5) is a chemical compound with the molecular formula C7H3Cl2NO2 and a molecular weight of 204.01 g/mol. IUPAC name: 5,6-dichloro-1,2-benzoxazol-3-one. InChIKey: IEAQWYJSDRWQBA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2 |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 5,6-dichloro-1,2-benzoxazol-3-one |
| InChIKey | IEAQWYJSDRWQBA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)ONC2=O |
Computed by PubChem (NCBI)