Products 1228182-43-1
CAS 1228182-43-1 appears in our catalog under these names: Miloxacin-d3, D3-Miloxacin, Concentration: 100 µg/ml Solvent: Methanol, D3-Miloxacin. Offered by: MedChemExpress, HPC Standards. Available pack sizes: 5mg, 1mg, 1x1ml, 1x10mg.
8-oxo-5-(trideuteriomethoxy)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid (CAS 1228182-43-1) is a chemical compound with the molecular formula C12H9NO6 and a molecular weight of 266.22 g/mol. IUPAC name: 8-oxo-5-(trideuteriomethoxy)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid. InChIKey: ABQYZRZVRIPTPI-FIBGUPNXSA-N.
| Molecular formula | C12H9NO6 |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | 8-oxo-5-(trideuteriomethoxy)-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| InChIKey | ABQYZRZVRIPTPI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])ON1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
Computed by PubChem (NCBI)