CAS 42406-53-1 appears in our catalog under these names: 2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)succinic acid, 95%, 2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)succinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(1,3-dioxoisoindol-2-yl)butanedioic acid (CAS 42406-53-1) is a chemical compound with the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)butanedioic acid. InChIKey: JHEGVHCZUULIPW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO6 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)butanedioic acid |
| InChIKey | JHEGVHCZUULIPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)