Products 438219-25-1

CAS 438219-25-1 is the registry number for 5-((4-Nitrophenoxy)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[(4-nitrophenoxy)methyl]furan-2-carboxylic acid (CAS 438219-25-1) is a chemical compound with the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. IUPAC name: 5-[(4-nitrophenoxy)methyl]furan-2-carboxylic acid. InChIKey: QBTFAJGZQGYZTH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO6
Molecular weight263.20 g/mol
IUPAC name5-[(4-nitrophenoxy)methyl]furan-2-carboxylic acid
InChIKeyQBTFAJGZQGYZTH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1[N+](=O)[O-])OCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)