CAS 364621-84-1 is the registry number for 5-(2-Nitrophenoxymethyl)furan-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-[(2-nitrophenoxy)methyl]furan-2-carboxylic acid (CAS 364621-84-1) is a chemical compound with the molecular formula C12H9NO6 and a molecular weight of 263.20 g/mol. IUPAC name: 5-[(2-nitrophenoxy)methyl]furan-2-carboxylic acid. InChIKey: YHAVDXJFCAOEPJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO6 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | 5-[(2-nitrophenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | YHAVDXJFCAOEPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)