CAS 1228386-26-2 appears in our catalog under these names: Methyl 6,6-dimethyl-4-oxotetrahydro-2H-pyran-3-carboxylate, 97%, Methyl 6,6-dimethyl-4-oxooxane-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Methyl 6,6-dimethyl-4-oxooxane-3-carboxylate (CAS 1228386-26-2) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: methyl 6,6-dimethyl-4-oxooxane-3-carboxylate. InChIKey: ILFIEQWBJKQSSX-UHFFFAOYSA-N.
| Molecular formula | C9H14O4 |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | methyl 6,6-dimethyl-4-oxooxane-3-carboxylate |
| InChIKey | ILFIEQWBJKQSSX-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(CO1)C(=O)OC)C |
Computed by PubChem (NCBI)