CAS 1228542-64-0 is the registry number for (2S)-2-((tert-Butoxy)carbonylamino)-2-(3-fluorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(2S)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1228542-64-0) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: (2S)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BMSUXJZKOGWPGP-JTQLQIEISA-N.
| Molecular formula | C13H16FNO4 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (2S)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BMSUXJZKOGWPGP-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC(=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)