CAS 209680-91-1 appears in our catalog under these names: Boc-(R)-2-amino-2-(3-fluorophenyl)acetic acid, (R)-2-((tert-butoxycarbonyl)amino)-2-(3-fluorophenyl)acetic acid, 98%, 98%, Boc-(R)-2-amino-2-(3-fluorophenyl)acetic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g, 10g, 25g.
(2R)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 209680-91-1) is a chemical compound with the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. IUPAC name: (2R)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BMSUXJZKOGWPGP-SNVBAGLBSA-N.
| Molecular formula | C13H16FNO4 |
|---|---|
| Molecular weight | 269.27 g/mol |
| IUPAC name | (2R)-2-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BMSUXJZKOGWPGP-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC(=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)