CAS 1228548-29-5 appears in our catalog under these names: (2R)-2-Amino-2-[3-(trifluoromethyl)phenyl]acetic acid, 95%, (R)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid, 98%, (R)–2–AMINO–2–(3–(TRIFLUOROMETHYL)PHENYL)ACETIC ACID, (R)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2R)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid (CAS 1228548-29-5) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2R)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid. InChIKey: SRHNOGZIXICHOU-SSDOTTSWSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2R)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | SRHNOGZIXICHOU-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)