Products 1228568-48-6
CAS 1228568-48-6 appears in our catalog under these names: (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid, 95%+, 95%+, (S)-2-amino-2-(3-(trifluoromethyl)phenyl)acetic acid, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid (CAS 1228568-48-6) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: (2S)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid. InChIKey: SRHNOGZIXICHOU-ZETCQYMHSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | (2S)-2-amino-2-[3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | SRHNOGZIXICHOU-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)