CAS 1228560-89-1 appears in our catalog under these names: (S)–2–(4–Chlorophenyl)pyrrolidine hydrochloride, (S)-2-(4-Chlorophenyl)pyrrolidine hydrochloride, 97%, 97%, (S)-2-(4-Chlorophenyl)pyrrolidine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-chlorophenyl)pyrrolidine;hydrochloride (CAS 1228560-89-1) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)pyrrolidine;hydrochloride. InChIKey: BVEQCCJUWYROBR-PPHPATTJSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | BVEQCCJUWYROBR-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)