Products 1228666-46-3

CAS 1228666-46-3 is the registry number for 5-Fluoro-2-pivalamidonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(2,2-dimethylpropanoylamino)-5-fluoropyridine-3-carboxylic acid (CAS 1228666-46-3) is a chemical compound with the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-5-fluoropyridine-3-carboxylic acid. InChIKey: YEIHHQAWOHUOPF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FN2O3
Molecular weight240.23 g/mol
IUPAC name2-(2,2-dimethylpropanoylamino)-5-fluoropyridine-3-carboxylic acid
InChIKeyYEIHHQAWOHUOPF-UHFFFAOYSA-N
SMILESCC(C)(C)C(=O)NC1=C(C=C(C=N1)F)C(=O)O

Computed by PubChem (NCBI)