CAS 1242137-20-7 appears in our catalog under these names: Enzalutamide Impurity 5, 2-((4-Carbamoyl-3-fluorophenyl)amino)-2-methylpropanoic acid, 98%, 2–((4–Carbamoyl–3–fluorophenyl)amino)–2–methylpropanoic acid, 2-((4-Carbamoyl-3-fluorophenyl)amino)-2-methylpropanoic acid, 95%, 95%, 2-((4-Carbamoyl-3-fluorophenyl)amino)-2-methylpropanoic acid, 95%. Offered by: Chemat Brand, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 1g, 100mg, 250mg, 50mg.
2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoic acid (CAS 1242137-20-7) is a chemical compound with the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. IUPAC name: 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoic acid. InChIKey: XBQJUHYDJFUQBE-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 2-(4-carbamoyl-3-fluoroanilino)-2-methylpropanoic acid |
| InChIKey | XBQJUHYDJFUQBE-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC1=CC(=C(C=C1)C(=O)N)F |
Computed by PubChem (NCBI)