CAS 474018-94-5 appears in our catalog under these names: N,N-Diethyl-4-fluoro-3-nitrobenzamide, 97%, N,N–Diethyl–4–fluoro–3–nitrobenzamide. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 250mg.
N,N-diethyl-4-fluoro-3-nitrobenzamide (CAS 474018-94-5) is a chemical compound with the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. IUPAC name: N,N-diethyl-4-fluoro-3-nitrobenzamide. InChIKey: MRVFZPHNDANYPK-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | N,N-diethyl-4-fluoro-3-nitrobenzamide |
| InChIKey | MRVFZPHNDANYPK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)