Products 923121-33-9
CAS 923121-33-9 is the registry number for 2-(Dimethylamino)-2-oxoethyl 2-amino-4-fluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(dimethylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate (CAS 923121-33-9) is a chemical compound with the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. IUPAC name: [2-(dimethylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate. InChIKey: YXYSHQWWQVDBKN-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | [2-(dimethylamino)-2-oxoethyl] 2-amino-4-fluorobenzoate |
| InChIKey | YXYSHQWWQVDBKN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)COC(=O)C1=C(C=C(C=C1)F)N |
Computed by PubChem (NCBI)