CAS 1228778-17-3 is the registry number for 5-Iodo-2-methyl-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-iodo-N,N,2-trimethylbenzamide (CAS 1228778-17-3) is a chemical compound with the molecular formula C10H12INO and a molecular weight of 289.11 g/mol. IUPAC name: 5-iodo-N,N,2-trimethylbenzamide. InChIKey: YAEOWGUGWMDNAH-UHFFFAOYSA-N.
| Molecular formula | C10H12INO |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 5-iodo-N,N,2-trimethylbenzamide |
| InChIKey | YAEOWGUGWMDNAH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(=O)N(C)C |
Computed by PubChem (NCBI)