CAS 425416-87-1 is the registry number for 4-Iodo-N-isopropylbenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
4-iodo-N-propan-2-ylbenzamide (CAS 425416-87-1) is a chemical compound with the molecular formula C10H12INO and a molecular weight of 289.11 g/mol. IUPAC name: 4-iodo-N-propan-2-ylbenzamide. InChIKey: DRCCJCULDBSFBM-UHFFFAOYSA-N.
| Molecular formula | C10H12INO |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 4-iodo-N-propan-2-ylbenzamide |
| InChIKey | DRCCJCULDBSFBM-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C=C1)I |
Computed by PubChem (NCBI)